CymitQuimica logo

CAS 1268334-79-7

:

7-Methyl-3,7,11-triazaspiro[5.6]dodecan-12-one

Description:
7-Methyl-3,7,11-triazaspiro[5.6]dodecan-12-one is a chemical compound characterized by its unique spirocyclic structure, which features a combination of nitrogen atoms within a dodecanone framework. The presence of three nitrogen atoms in the triaza configuration contributes to its potential biological activity and interaction with various receptors. The methyl group at the 7-position enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. This compound may exhibit properties typical of spiro compounds, such as rigidity and conformational constraints, which can affect its reactivity and interaction with other molecules. Additionally, the ketone functional group at the 12-position may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Overall, the structural characteristics of 7-Methyl-3,7,11-triazaspiro[5.6]dodecan-12-one suggest it could be of interest in medicinal chemistry and materials science, although specific applications would depend on further research and characterization.
Formula:C10H19N3O
InChI:InChI=1S/C10H19N3O/c1-13-8-2-5-12-9(14)10(13)3-6-11-7-4-10/h11H,2-8H2,1H3,(H,12,14)
InChI key:InChIKey=GZQPNYYGULUSCJ-UHFFFAOYSA-N
SMILES:O=C1C2(N(C)CCCN1)CCNCC2
Synonyms:
  • 3,7,11-Triazaspiro[5.6]dodecan-12-one, 7-methyl-
  • 7-Methyl-3,7,11-triazaspiro[5.6]dodecan-12-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.