CAS 1268334-82-2

2-Methyl-5-[5-(trifluoromethyl)-3-isoxazolyl]-3-thiophenesulfonyl chloride

Description:

2-Methyl-5-[5-(trifluoromethyl)-3-isoxazolyl]-3-thiophenesulfonyl chloride is a chemical compound characterized by its complex structure, which includes a thiophene ring, an isoxazole moiety, and a sulfonyl chloride functional group. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its reactivity and biological activity. This compound is likely to exhibit properties typical of sulfonyl chlorides, such as being a potent electrophile, making it useful in various synthetic applications, particularly in the formation of sulfonamides and other derivatives. The isoxazole ring contributes to its potential pharmacological properties, as compounds containing this heterocyclic structure are often investigated for their biological activities. Additionally, the methyl group at the 2-position of the thiophene ring may affect the compound's steric and electronic properties, influencing its reactivity and interactions with biological targets. Overall, this compound's unique structural features suggest potential utility in medicinal chemistry and material science.

Formula: C₉H₅ClF₃NO₃S₂

InChI: InChI=1S/C9H5ClF3NO3S2/c1-4-7(19(10,15)16)3-6(18-4)5-2-8(17-14-5)9(11,12)13/h2-3H,1H3

InChI key: InChIKey=DRYHDNTYQPJDLU-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C=1C=C(SC1C)C=2C=C(C(F)(F)F)ON2

Synonyms:

• 3-Thiophenesulfonyl chloride, 2-methyl-5-[5-(trifluoromethyl)-3-isoxazolyl]-
• 2-Methyl-5-[5-(trifluoromethyl)-3-isoxazolyl]-3-thiophenesulfonyl chloride

2-methyl-5-[5-(trifluoromethyl)-3-isoxazolyl]-3-thiophenesulfonyl chloride

CAS: 1268334-82-2

Formula: C₉H₅ClF₃NO₃S₂

Purity: 95.0%

Color and Shape: Brown powder

Molecular weight: 331.71

Ref: 10-F312904