CAS 126840-22-0

1-pentan-D11-ol

Description:

1-Pentan-D11-ol, with the CAS number 126840-22-0, is a deuterated alcohol that serves as a valuable compound in various chemical and biochemical applications. Its molecular structure consists of a five-carbon chain (pentane) with a hydroxyl (-OH) functional group, making it a primary alcohol. The presence of deuterium (D) in place of hydrogen in the alkyl chain enhances its utility in NMR spectroscopy and other analytical techniques, allowing for the study of reaction mechanisms and molecular interactions with greater precision. 1-Pentan-D11-ol is typically colorless and may exhibit a mild odor. It is soluble in water and organic solvents, which makes it versatile for use in laboratory settings. Additionally, due to its structural characteristics, it can participate in various chemical reactions, including esterification and oxidation. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₅HD₁₁O

InChI: InChI=1/C5H12O/c1-2-3-4-5-6/h6H,2-5H2,1H3/i1D3,2D2,3D2,4D2,5D2

SMILES: C(C(C(C(C(O)([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])([2H])[2H]

Synonyms:

• (2H11)pentan-1-ol

n-Pentyl-d11 Alcohol

CAS: 126840-22-0

Formula: CD₃(CD₂)₄OH

Purity: 98 atom % D

Color and Shape: Colorless Liquid.

Molecular weight: 99.15786

Ref: 3U-D3976

1-Pentanol-d11

Controlled Product

CAS: 126840-22-0

Formula: C₅HD₁₁O

Color and Shape: Neat

Molecular weight: 99.22

Ref: TR-P227292