CAS 1268444-86-5

1-(5-Chloro-2-thienyl)cyclopropanecarboxylic acid

Description:

1-(5-Chloro-2-thienyl)cyclopropanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a thienyl group substituted with a chlorine atom. This compound features a carboxylic acid functional group, which contributes to its acidic properties and potential reactivity. The presence of the thienyl moiety, a five-membered aromatic ring containing sulfur, imparts distinct electronic and steric characteristics, influencing its chemical behavior and interactions. The chlorine substituent enhances the compound's lipophilicity and may affect its biological activity. This compound may be of interest in pharmaceutical research due to its potential applications in drug development, particularly in the design of molecules with specific biological targets. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties can be further explored through various analytical methods such as NMR, IR spectroscopy, and mass spectrometry. Overall, 1-(5-Chloro-2-thienyl)cyclopropanecarboxylic acid represents a versatile scaffold for further chemical exploration and application.

Formula: C₈H₇ClO₂S

InChI: InChI=1S/C8H7ClO2S/c9-6-2-1-5(12-6)8(3-4-8)7(10)11/h1-2H,3-4H2,(H,10,11)

InChI key: InChIKey=GISSDTFQIWFWLK-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(CC1)C=2SC(Cl)=CC2

Synonyms:

• Cyclopropanecarboxylic acid, 1-(5-chloro-2-thienyl)-
• 1-(5-Chlorothiophen-2-yl)cyclopropane-1-carboxylic acid
• 1-(5-Chloro-2-thienyl)cyclopropanecarboxylic acid