CymitQuimica logo

CAS 1268517-84-5

:

4-(Bromomethyl)-2-(difluoromethoxy)pyridine

Description:
4-(Bromomethyl)-2-(difluoromethoxy)pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromomethyl group indicates that a bromomethyl substituent is attached to the fourth carbon of the pyridine ring, while the difluoromethoxy group, which consists of a methoxy group (–OCH3) substituted with two fluorine atoms, is located at the second position. This compound is typically used in organic synthesis and medicinal chemistry due to its potential as an intermediate in the development of pharmaceuticals. Its unique structure imparts specific reactivity and properties, making it valuable in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of both bromine and fluorine atoms enhances its electrophilic character, which can be exploited in further synthetic applications. Additionally, the compound's solubility and stability can vary depending on the solvent and conditions used, which is important for its practical applications in laboratory settings.
Formula:C7H6BrF2NO
InChI:InChI=1S/C7H6BrF2NO/c8-4-5-1-2-11-6(3-5)12-7(9)10/h1-3,7H,4H2
InChI key:InChIKey=HXWAYWSNGXCTEO-UHFFFAOYSA-N
SMILES:O(C(F)F)C1=CC(CBr)=CC=N1
Synonyms:
  • 4-(Bromomethyl)-2-(difluoromethoxy)pyridine
  • Pyridine, 4-(bromomethyl)-2-(difluoromethoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.