CymitQuimica logo

CAS 1268519-44-3

:

Methyl α-amino-2-pyrimidineacetate

Description:
Methyl α-amino-2-pyrimidineacetate, identified by its CAS number 1268519-44-3, is a chemical compound that features a pyrimidine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. This compound is characterized by the presence of an amino group and an acetate moiety, contributing to its potential as a building block in pharmaceutical synthesis and medicinal chemistry. The methyl ester group enhances its solubility and reactivity, making it suitable for various chemical reactions. Methyl α-amino-2-pyrimidineacetate may exhibit biological activity, potentially influencing metabolic pathways or serving as a precursor for more complex molecules. Its structural features suggest that it could interact with biological targets, making it of interest in drug development. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions such as pH and temperature. Proper handling and storage are essential to maintain its integrity for research and application purposes.
Formula:C7H9N3O2
InChI:InChI=1S/C7H9N3O2/c1-12-7(11)5(8)6-9-3-2-4-10-6/h2-5H,8H2,1H3
InChI key:InChIKey=NBPCBQYLISHQNY-UHFFFAOYSA-N
SMILES:C(C(OC)=O)(N)C=1N=CC=CN1
Synonyms:
  • Methyl α-amino-2-pyrimidineacetate
  • 2-Pyrimidineacetic acid, α-amino-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.