
CAS 1268519-63-6
:1-[(1,1-Dimethylethoxy)carbonyl]-α-fluoro-4-piperidinepropanoic acid
Description:
1-[(1,1-Dimethylethoxy)carbonyl]-α-fluoro-4-piperidinepropanoic acid is a chemical compound characterized by its unique structural features, which include a piperidine ring and a fluoro substituent. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has a bulky protective group that can influence its reactivity and solubility. This compound is likely to exhibit properties typical of amino acids, given its carboxylic acid functional group, which can participate in acid-base reactions. The α-fluoro substituent may impart specific biological activity or enhance lipophilicity, making it of interest in medicinal chemistry. Additionally, the piperidine moiety can contribute to the compound's pharmacological profile, as piperidine derivatives are often found in various pharmaceuticals. Overall, this compound's characteristics suggest potential applications in drug development, particularly in the design of novel therapeutic agents. However, detailed studies would be necessary to fully understand its chemical behavior and biological activity.
Formula:C13H22FNO4
InChI:InChI=1S/C13H22FNO4/c1-13(2,3)19-12(18)15-6-4-9(5-7-15)8-10(14)11(16)17/h9-10H,4-8H2,1-3H3,(H,16,17)
InChI key:InChIKey=OPRADHIGTPXWNF-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)F)C1CCN(C(OC(C)(C)C)=O)CC1
Synonyms:- 4-Piperidinepropanoic acid, 1-[(1,1-dimethylethoxy)carbonyl]-α-fluoro-
- 2-Fluoro-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]propanoic acid
- 1-[(1,1-Dimethylethoxy)carbonyl]-α-fluoro-4-piperidinepropanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.