CAS 1268519-85-2

1,2-Dimethyl-L-proline

Description:

1,2-Dimethyl-L-proline is a cyclic amino acid derivative characterized by its unique structure, which includes a five-membered ring containing a nitrogen atom. This compound features two methyl groups attached to the proline backbone, specifically at the 1 and 2 positions, which influences its steric and electronic properties. It is classified as a chiral molecule, with the L-configuration indicating its specific stereochemistry, which is crucial for its biological activity and interactions. 1,2-Dimethyl-L-proline is often studied for its potential applications in pharmaceuticals and as a building block in organic synthesis, particularly in the development of peptide-based drugs. Its solubility and reactivity can vary depending on the solvent and conditions, making it a versatile compound in research. Additionally, the presence of the proline structure may impart unique conformational characteristics that can affect its role in biological systems, including enzyme catalysis and molecular recognition processes.

Formula: C₇H₁₃NO₂

InChI: InChI=1S/C7H13NO2/c1-7(6(9)10)4-3-5-8(7)2/h3-5H2,1-2H3,(H,9,10)/t7-/m0/s1

InChI key: InChIKey=BWNGEDLBTNTBMD-ZETCQYMHSA-N

SMILES: C(O)(=O)[C@@]1(C)N(C)CCC1

Synonyms:

• L-Proline, 1,2-dimethyl-
• (2S)-1,2-Dimethylpyrrolidine-2-carboxylic acid
• 1,2-Dimethyl-L-proline

L-Proline, 1,2-dimethyl-

CAS: 1268519-85-2

Formula: C₇H₁₃NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 143.1836

Ref: IN-DA009WE1