
CAS 1268520-14-4
:(αS)-α,1-Dimethyl-4-piperidinemethanamine
Description:
(αS)-α,1-Dimethyl-4-piperidinemethanamine, identified by its CAS number 1268520-14-4, is a chemical compound characterized by its piperidine structure, which features a six-membered ring containing nitrogen. This compound is a chiral amine, with the (αS) designation indicating its specific stereochemistry. It typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of dimethyl groups contributes to its steric hindrance, potentially affecting its reactivity and interactions with biological systems. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting the central nervous system, due to its structural similarity to other biologically active molecules. Its synthesis and characterization would involve standard organic chemistry techniques, and its behavior in biological systems would require further investigation to elucidate its pharmacological properties and potential applications.
Formula:C8H18N2
InChI:InChI=1S/C8H18N2/c1-7(9)8-3-5-10(2)6-4-8/h7-8H,3-6,9H2,1-2H3/t7-/m0/s1
InChI key:InChIKey=YYBLKINSGHLYAR-ZETCQYMHSA-N
SMILES:[C@@H](C)(N)C1CCN(C)CC1
Synonyms:- (αS)-α,1-Dimethyl-4-piperidinemethanamine
- 4-Piperidinemethanamine, α,1-dimethyl-, (αS)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.