CAS 1268520-24-6

1,1-Dimethylethyl 3-(aminomethyl)-2-oxa-7-azaspiro[4.4]nonane-7-carboxylate

Description:

1,1-Dimethylethyl 3-(aminomethyl)-2-oxa-7-azaspiro[4.4]nonane-7-carboxylate, identified by its CAS number 1268520-24-6, is a chemical compound characterized by its complex spirocyclic structure, which includes both nitrogen and oxygen heteroatoms. This compound features a dimethyl group that contributes to its steric bulk, influencing its reactivity and interaction with biological systems. The presence of an aminomethyl group suggests potential for hydrogen bonding and reactivity, making it of interest in medicinal chemistry. The oxa and aza components indicate that the molecule contains both an ether and an amine, which can affect its solubility and stability. Additionally, the carboxylate functional group may impart acidic properties, influencing its behavior in various chemical environments. Overall, this compound's unique structural features may confer specific pharmacological properties, making it a candidate for further research in drug development or other applications in organic synthesis.

Formula: C₁₃H₂₄N₂O₃

InChI: InChI=1S/C13H24N2O3/c1-12(2,3)18-11(16)15-5-4-13(8-15)6-10(7-14)17-9-13/h10H,4-9,14H2,1-3H3

InChI key: InChIKey=SKJDWIYFGRYNMX-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC2(CC(CN)OC2)CC1

Synonyms:

• 1,1-Dimethylethyl 3-(aminomethyl)-2-oxa-7-azaspiro[4.4]nonane-7-carboxylate
• 2-Oxa-7-azaspiro[4.4]nonane-7-carboxylic acid, 3-(aminomethyl)-, 1,1-dimethylethyl ester

tert-Butyl 3-(aminomethyl)-2-oxa-7-azaspiro[4.4]nonane-7-carboxylate

CAS: 1268520-24-6

Versatile small molecule scaffold

Formula: C₁₃H₂₄N₂O₃

Purity: Min. 95%

Molecular weight: 256.34 g/mol

Ref: 3D-TAC52024