CymitQuimica logo

CAS 1268520-73-5

:

1H-Indazole-3-propanol

Description:
1H-Indazole-3-propanol, with the CAS number 1268520-73-5, is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a propanol side chain at the 3-position of the indazole ring, contributing to its unique properties. Typically, indazole derivatives exhibit interesting biological activities, making them of interest in medicinal chemistry. The presence of the hydroxyl (-OH) group in the propanol moiety can enhance solubility in polar solvents and may influence the compound's reactivity and interaction with biological targets. The compound's molecular structure suggests potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Additionally, its stability, solubility, and reactivity can be influenced by various factors such as pH and the presence of other functional groups. Overall, 1H-Indazole-3-propanol represents a versatile scaffold for further chemical modifications and investigations in drug discovery.
Formula:C10H12N2O
InChI:InChI=1S/C10H12N2O/c13-7-3-6-10-8-4-1-2-5-9(8)11-12-10/h1-2,4-5,13H,3,6-7H2,(H,11,12)
InChI key:InChIKey=TUAOYARZDJJOBA-UHFFFAOYSA-N
SMILES:C(CCO)C=1C=2C(NN1)=CC=CC2
Synonyms:
  • 1H-Indazole-3-propanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.