CymitQuimica logo

CAS 1268520-96-2

:

4-Amino-2-methyl-8-quinazolinecarboxylic acid

Description:
4-Amino-2-methyl-8-quinazolinecarboxylic acid is a chemical compound characterized by its quinazoline structure, which consists of a fused benzene and pyrimidine ring. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its potential as a biologically active molecule. The presence of the methyl group at the second position of the quinazoline ring influences its solubility and reactivity. Typically, compounds of this nature may exhibit properties such as moderate to high solubility in polar solvents, and they may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, its unique functional groups may allow for interactions with biological macromolecules, making it a candidate for further research in drug design and development. As with many quinazoline derivatives, it may also exhibit interesting pharmacological properties, warranting investigation into its therapeutic potential.
Formula:C10H9N3O2
InChI:InChI=1S/C10H9N3O2/c1-5-12-8-6(9(11)13-5)3-2-4-7(8)10(14)15/h2-4H,1H3,(H,14,15)(H2,11,12,13)
InChI key:InChIKey=BGNGPPPYZBYQQU-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(C(N)=NC(C)=N2)C=CC1
Synonyms:
  • 4-Amino-2-methyl-8-quinazolinecarboxylic acid
  • 4-Amino-2-methylquinazoline-8-carboxylic acid
  • 8-Quinazolinecarboxylic acid, 4-amino-2-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.