CymitQuimica logo

CAS 1268521-59-0

:

7-Chloro-5-(trifluoromethyl)furo[3,2-b]pyridine-6-carbonitrile

Description:
7-Chloro-5-(trifluoromethyl)furo[3,2-b]pyridine-6-carbonitrile is a heterocyclic compound characterized by its complex structure, which includes a fused furo and pyridine ring system. The presence of a chloro group and a trifluoromethyl group contributes to its unique chemical properties, enhancing its lipophilicity and potentially influencing its biological activity. The carbonitrile functional group introduces a polar character, which can affect solubility and reactivity. This compound is typically of interest in medicinal chemistry and drug development due to its potential pharmacological properties. Its molecular structure suggests that it may interact with biological targets, making it a candidate for further research in areas such as agrochemicals or pharmaceuticals. Additionally, the presence of multiple electronegative atoms (chlorine and fluorine) can influence the compound's electronic properties, stability, and reactivity, making it a subject of interest for synthetic chemists and researchers in material science.
Formula:C9H2ClF3N2O
InChI:InChI=1S/C9H2ClF3N2O/c10-6-4(3-14)8(9(11,12)13)15-5-1-2-16-7(5)6/h1-2H
InChI key:InChIKey=QUVRXCZMOUEPEC-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C(F)(F)F)N=C2C(=C1Cl)OC=C2
Synonyms:
  • 7-Chloro-5-(trifluoromethyl)furo[3,2-b]pyridine-6-carbonitrile
  • Furo[3,2-b]pyridine-6-carbonitrile, 7-chloro-5-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.