CAS 1268521-85-2
:trans-3-Hydroxycyclobutanecarboxylic acid
Description:
Trans-3-Hydroxycyclobutanecarboxylic acid is a cyclic organic compound characterized by a cyclobutane ring with a hydroxyl group and a carboxylic acid functional group. The "trans" configuration indicates that the hydroxyl and carboxylic acid groups are positioned on opposite sides of the cyclobutane ring, which influences its stereochemistry and reactivity. This compound is typically a colorless to pale yellow solid at room temperature and is soluble in polar solvents due to the presence of the hydroxyl and carboxylic acid groups, which can engage in hydrogen bonding. Its unique structure may impart specific biological activities, making it of interest in medicinal chemistry and organic synthesis. The presence of both functional groups suggests potential for various chemical reactions, including esterification and dehydration. Additionally, the compound's properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other chemical species. Overall, trans-3-Hydroxycyclobutanecarboxylic acid represents a fascinating subject for further research in organic and medicinal chemistry.
Formula:C5H8O3
InChI:InChI=1/C5H8O3/c6-4-1-3(2-4)5(7)8/h3-4,6H,1-2H2,(H,7,8)/t3-,4-
InChI key:InChIKey=ZSHGVMYLGGANKU-JPYJGEKTNA-N
SMILES:C(O)(=O)[C@@H]1C[C@@H](O)C1
Synonyms:- Cyclobutanecarboxylic acid, 3-hydroxy-, trans-
- trans-3-Hydroxycyclobutanecarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
trans-3-Hydroxycyclobutanecarboxylic acid
CAS:Formula:C5H8O3Purity:97%Color and Shape:SolidMolecular weight:116.1152trans-3-Hydroxycyclobutanecarboxylic acid
CAS:trans-3-Hydroxycyclobutanecarboxylic acidPurity:97%Molecular weight:116.12g/moltrans-3-Hydroxycyclobutanecarboxylic acid
CAS:Formula:C5H8O3Purity:97%Color and Shape:SolidMolecular weight:116.116trans-3-Hydroxycyclobutanecarboxylic acid
CAS:3-Hydroxycyclobutanecarboxylic acid is an organic compound that belongs to the class of hydroxycarboxylic acids. It is a colorless liquid with a boiling point of 170 degrees Celsius and a melting point of -63 degrees Celsius. 3-Hydroxycyclobutanecarboxylic acid has been shown as an emission source for positron, which is used in positron emission tomography (PET). The compound can be synthesized from formulae and implemented on a large scale. This process includes the use of metal alkyls, such as group metals, as catalysts. 3-Hydroxycyclobutanecarboxylic acid is also used in positron emission studies to identify amino acids and other substances by radioisotopes.Purity:Min. 95%



