CAS 126861-72-1
:2-amino-1-methyl-6-(4-hydroxyphenyl)imidazo(4,5-b)pyridine
Description:
2-Amino-1-methyl-6-(4-hydroxyphenyl)imidazo(4,5-b)pyridine, with the CAS number 126861-72-1, is a heterocyclic organic compound characterized by its imidazo-pyridine structure, which incorporates both amino and hydroxy functional groups. This compound features a methyl group at the 1-position and a 4-hydroxyphenyl group at the 6-position of the imidazo ring, contributing to its potential biological activity. It is known for its role in various biochemical processes and has been studied for its implications in mutagenicity and carcinogenicity, particularly in relation to food chemistry and the formation of heterocyclic amines during cooking. The presence of the amino and hydroxy groups enhances its reactivity and solubility in polar solvents, making it of interest in medicinal chemistry and pharmacology. Additionally, its structural features suggest potential interactions with biological macromolecules, which may influence its pharmacokinetic properties. Overall, this compound exemplifies the complexity and significance of heterocyclic compounds in both synthetic and natural chemistry contexts.
Formula:C13H12N4O
InChI:InChI=1/C13H12N4O/c1-17-11-7-6-10(15-12(11)16-13(17)14)8-2-4-9(18)5-3-8/h2-7,15H,1H3,(H2,14,16)
SMILES:Cn1c2ccc(=C3C=CC(=O)C=C3)[nH]c2[nH]c1=N
Synonyms:- 4'-OH-Phip
- 4-(2-Amino-1-methyl-1H-imidazo(4,5-b)pyridin-6-yl)phenol
- Phenol, 4-(2-amino-1-methyl-1H-imidazo(4,5-b)pyridin-6-yl)-
- 4-(2-amino-1-methyl-1,4-dihydro-5H-imidazo[4,5-b]pyridin-5-ylidene)cyclohexa-2,5-dien-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Phenol, 4-(2-amino-1-methyl-1H-imidazo[4,5-b]pyridin-6-yl)-
CAS:Formula:C13H12N4OColor and Shape:SolidMolecular weight:240.2606

