CAS 126866-16-8
:2-(4-Chlorophenyl)-1-(4-fluorophenyl)ethanone
Description:
2-(4-Chlorophenyl)-1-(4-fluorophenyl)ethanone, with the CAS number 126866-16-8, is an organic compound characterized by its ketone functional group and the presence of both chlorinated and fluorinated aromatic rings. This compound typically appears as a solid at room temperature and is known for its potential applications in pharmaceuticals and organic synthesis. The presence of the 4-chlorophenyl and 4-fluorophenyl groups contributes to its unique electronic properties, which can influence its reactivity and interaction with biological targets. The compound may exhibit moderate to high lipophilicity due to its aromatic structure, affecting its solubility in various solvents. Additionally, it may possess specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, 2-(4-Chlorophenyl)-1-(4-fluorophenyl)ethanone serves as a valuable building block in synthetic chemistry and drug development.
Formula:C14H10ClFO
InChI:InChI=1S/C14H10ClFO/c15-12-5-1-10(2-6-12)9-14(17)11-3-7-13(16)8-4-11/h1-8H,9H2
InChI key:InChIKey=FKVQOVGOFBRALU-UHFFFAOYSA-N
SMILES:C(CC1=CC=C(Cl)C=C1)(=O)C2=CC=C(F)C=C2
Synonyms:- 2-(4-Chlorophenyl)-1-(4-fluorophenyl)ethanone
- Ethanone, 2-(4-chlorophenyl)-1-(4-fluorophenyl)-
- 2-(4-Chlorophenyl)-1-(4-fluorophenyl)ethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
