CAS 12687-98-8
:14,16,18,20,24,26-Hexahydroxy-3-methyl-36-(1-methylethyl)oxacyclohexatriaconta-3,5,7,9,11,13-pentaene-2,22,28-trione
Description:
The chemical substance known as "14,16,18,20,24,26-Hexahydroxy-3-methyl-36-(1-methylethyl)oxacyclohexatriaconta-3,5,7,9,11,13-pentaene-2,22,28-trione," with the CAS number 12687-98-8, is a complex organic compound characterized by its multiple hydroxyl (-OH) groups and a unique structural framework that includes a long carbon chain and a cyclic ether component. This compound features a series of conjugated double bonds, which may contribute to its potential reactivity and stability under various conditions. The presence of multiple hydroxyl groups suggests that it may exhibit strong hydrogen bonding capabilities, influencing its solubility and interaction with other molecules. Additionally, the methyl and isopropyl substituents may affect its steric properties and overall molecular conformation. Such compounds are often of interest in fields like organic synthesis, materials science, and medicinal chemistry due to their potential applications in drug development and as functional materials. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C39H62O10
InChI:InChI=1S/C39H62O10/c1-28(2)38-20-16-12-8-11-15-19-31(41)22-33(43)24-35(45)26-37(47)27-36(46)25-34(44)23-32(42)21-30(40)18-14-10-7-5-4-6-9-13-17-29(3)39(48)49-38/h4-7,9-10,13-14,17,28,30,32-36,38,40,42-46H,8,11-12,15-16,18-27H2,1-3H3
InChI key:InChIKey=YHVUXVJMFMUNKX-UHFFFAOYSA-N
SMILES:C(C)(C)C1OC(=O)C(C)=CC=CC=CC=CC=CCC(O)CC(O)CC(O)CC(O)CC(=O)CC(O)CC(O)CC(=O)CCCCCCC1
Synonyms:- (3E,5E,7E,9E,11E)-14,16,18,20,24,26-hexahydroxy-3-methyl-36-(1-methylethyl)oxacyclohexatriaconta-3,5,7,9,11-pentaene-2,22,28-trione
- Dermostatin A, 16,34-didemethyl-21,27,29,31-tetradeoxy-12,13,32,33-tetrahydro-13-hydroxy-2-methyl-21,27-dioxo-
- Roseofungin
- Oxacyclohexatriacontane, dermostatin A deriv.
- Oxacyclohexatriaconta-3,5,7,9,11,13-pentaene-2,22,28-trione, 14,16,18,20,24,26-hexahydroxy-3-methyl-36-(1-methylethyl)-
- Dermostatin A, 16,34-didemethyl-21,27,29,31-tetradeoxy-12,13,32,33-tetrahydro-13-hydroxy-2-methyl-21,27-dioxo-
- Rozeofungin
- 14,16,18,20,24,26-Hexahydroxy-3-methyl-36-(1-methylethyl)oxacyclohexatriaconta-3,5,7,9,11,13-pentaene-2,22,28-trione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Roseofungin
CAS:Roseofungin is a polyenic macrolide antibiotic with the subgroup of carbonyl conjugated pentaenes.Formula:C39H62O10Color and Shape:SolidMolecular weight:690.915
