CAS 126871-92-9
:N(epsilon)-(diazotrifluoroethyl)benzoyl-Lys(8)-cyclosporin
Description:
N(epsilon)-(diazotrifluoroethyl)benzoyl-Lys(8)-cyclosporin, with CAS number 126871-92-9, is a synthetic derivative of cyclosporin, a cyclic peptide known for its immunosuppressive properties. This compound features a modification at the lysine residue, where a diazotrifluoroethyl group is attached to the epsilon amino group of lysine, enhancing its chemical reactivity and potentially altering its biological activity. The presence of the trifluoroethyl group may impart unique hydrophobic characteristics, influencing solubility and interaction with biological membranes. Cyclosporin itself is primarily used in organ transplantation and autoimmune diseases due to its ability to inhibit T-cell activation. The modification in this derivative may affect its pharmacokinetics, efficacy, and safety profile, making it a subject of interest in medicinal chemistry and drug development. As with many cyclosporin derivatives, understanding the structure-activity relationship is crucial for optimizing therapeutic applications while minimizing side effects.
Formula:C74H121F3N14O13
InChI:InChI=1S/C74H121F3N14O13/c1-24-26-29-47(15)61(93)60-67(98)81-51(25-2)68(99)85(17)40-57(92)86(18)53(36-41(3)4)66(97)83-58(45(11)12)72(103)87(19)54(37-42(5)6)65(96)80-48(16)63(94)82-52(30-27-28-35-79-64(95)50-33-31-49(32-34-50)62(84-78)74(75,76)77)69(100)88(20)55(38-43(7)8)70(101)89(21)56(39-44(9)10)71(102)90(22)59(46(13)14)73(104)91(60)23/h24,26,31-34,41-48,51-56,58-61,93H,25,27-30,35-40H2,1-23H3,(H,79,95)(H,80,96)(H,81,98)(H,82,94)(H,83,97)
InChI key:InChIKey=MJGNMTOCIMTJOT-UHFFFAOYSA-N
SMILES:C(C(CC=CC)C)(O)C1N(C)C(=O)C(C(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O)C(CCCCNC(=O)C2=CC=C(C(C(F)(F)F)=[N+]=[N-])C=C2)NC(=O)C(C)NC(=O)C(CC(C)C)N(C)C(=O)C(C(C)C)NC(=O)C(CC(C)C)N(C)C(=O)CN(C)C(=O)C(CC)NC1=O
Synonyms:- (E)-[(4E)-4-(1-diazonio-2,2,2-trifluoroethylidene)cyclohexa-2,5-dien-1-ylidene][(4-{17-ethyl-14-[(4E)-1-hydroxy-2-methylhex-4-en-1-yl]-4,7,10,13,19,22,28,32-octamethyl-11,26-bis(1-methylethyl)-5,8,23,29-tetrakis(2-methylpropyl)-3,6,9,12,15,18,21,24,27,30,33-undecaoxo-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontan-2-yl}butyl)amino]methanolate
- 1,4,7,10,13,16,19,22,25,28,31-Undecaazacyclotritriacontane, cyclic peptide deriv.
- Csdz
- Cyclosporin A, 2-[N<sup>6</sup>-[4-(1-diazo-2,2,2-trifluoroethyl)benzoyl]-<span class="text-smallcaps">D</span>-lysine]-
- Cyclosporin A, 2-[N6-[4-(1-diazo-2,2,2-trifluoroethyl)benzoyl]-D-lysine]-
- N(epsilon)-(Diazotrifluoroethyl)benzoyl-lys(8)-cyclosporin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.