CAS 1268729-75-4

1-(1,1-Dimethylethyl) 2-methyl (2S,4R)-4-fluoro-5-oxo-1,2-pyrrolidinedicarboxylate

Description:

1-(1,1-Dimethylethyl) 2-methyl (2S,4R)-4-fluoro-5-oxo-1,2-pyrrolidinedicarboxylate is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring with multiple functional groups. The presence of a fluoro substituent indicates potential reactivity and influence on the compound's physical properties, such as polarity and solubility. The two carboxylate groups suggest that the compound may exhibit acidic behavior, while the dimethyl and methyl groups contribute to its steric bulk, potentially affecting its biological activity and interactions. This compound may be of interest in medicinal chemistry due to its structural features, which could impart specific pharmacological properties. Additionally, the stereochemistry indicated by the (2S,4R) configuration suggests that the compound may exhibit chirality, which can significantly influence its biological activity and interactions with enzymes or receptors. Overall, this compound's unique characteristics make it a candidate for further investigation in various chemical and pharmaceutical applications.

Formula: C₁₁H₁₆FNO₅

InChI: InChI=1S/C11H16FNO5/c1-11(2,3)18-10(16)13-7(9(15)17-4)5-6(12)8(13)14/h6-7H,5H2,1-4H3/t6-,7+/m1/s1

InChI key: InChIKey=QBKBNRNCKCOQQN-RQJHMYQMSA-N

SMILES: C(OC(C)(C)C)(=O)N1[C@H](C(OC)=O)C[C@@H](F)C1=O

Synonyms:

• 1,2-Pyrrolidinedicarboxylic acid, 4-fluoro-5-oxo-, 1-(1,1-dimethylethyl) 2-methyl ester, (2S,4R)-
• 1-(1,1-Dimethylethyl) 2-methyl (2S,4R)-4-fluoro-5-oxo-1,2-pyrrolidinedicarboxylate