CAS 1268810-10-1

3-[1-[[(1,1-Dimethylethoxy)carbonyl]amino]cyclopropyl]-2-propynoic acid

Description:

3-[1-[[(1,1-Dimethylethoxy)carbonyl]amino]cyclopropyl]-2-propynoic acid is a chemical compound characterized by its unique structural features, which include a cyclopropyl group and a propynoic acid moiety. The presence of the 1,1-dimethylethoxycarbonyl group suggests that it has protective or modifying functionalities, which can influence its reactivity and solubility. This compound is likely to exhibit properties typical of both amino acids and alkyne-containing compounds, potentially participating in various chemical reactions such as nucleophilic substitutions or coupling reactions. Its cyclopropyl structure may impart strain, affecting the compound's stability and reactivity. Additionally, the presence of the carboxylic acid group indicates that it can act as an acid, contributing to its overall acidity and potential interactions in biological systems. Overall, this compound's characteristics make it of interest in synthetic organic chemistry and possibly in pharmaceutical applications, where its unique structure could be leveraged for specific biological activities or as a building block in drug development.

Formula: C₁₁H₁₅NO₄

InChI: InChI=1S/C11H15NO4/c1-10(2,3)16-9(15)12-11(6-7-11)5-4-8(13)14/h6-7H2,1-3H3,(H,12,15)(H,13,14)

InChI key: InChIKey=QFMHBVNKJIYFMA-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1(C#CC(O)=O)CC1

Synonyms:

• 2-Propynoic acid, 3-[1-[[(1,1-dimethylethoxy)carbonyl]amino]cyclopropyl]-
• 3-[1-[[(1,1-Dimethylethoxy)carbonyl]amino]cyclopropyl]-2-propynoic acid