
CAS 1268810-14-5
:1-[2-(Trimethylsilyl)ethynyl]cyclobutanecarboxylic acid
Description:
1-[2-(Trimethylsilyl)ethynyl]cyclobutanecarboxylic acid is an organic compound characterized by its unique structure, which includes a cyclobutane ring and a trimethylsilyl group attached to an ethynyl moiety. This compound features a carboxylic acid functional group, which contributes to its acidity and reactivity. The presence of the trimethylsilyl group enhances its stability and solubility in organic solvents, making it useful in various synthetic applications. The ethynyl group introduces a triple bond, which can participate in further chemical reactions, such as cross-coupling or addition reactions. Additionally, the cyclobutane ring provides a rigid framework that can influence the compound's conformational properties and reactivity. Overall, this compound is of interest in organic synthesis and materials science, particularly in the development of novel chemical intermediates and functional materials. Its specific properties, such as melting point, boiling point, and spectral characteristics, would typically be determined through experimental methods.
Formula:C10H16O2Si
InChI:InChI=1S/C10H16O2Si/c1-13(2,3)8-7-10(9(11)12)5-4-6-10/h4-6H2,1-3H3,(H,11,12)
InChI key:InChIKey=ICEFRTMWNGJLFX-UHFFFAOYSA-N
SMILES:C(#C[Si](C)(C)C)C1(C(O)=O)CCC1
Synonyms:- Cyclobutanecarboxylic acid, 1-[2-(trimethylsilyl)ethynyl]-
- 1-[2-(Trimethylsilyl)ethynyl]cyclobutanecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.