CAS 1268810-15-6

1,1-Dimethylethyl N-[1-[2-(trimethylsilyl)ethynyl]cyclobutyl]carbamate

Description:

1,1-Dimethylethyl N-[1-[2-(trimethylsilyl)ethynyl]cyclobutyl]carbamate, identified by its CAS number 1268810-15-6, is a chemical compound that features a complex structure incorporating a carbamate functional group. This compound is characterized by the presence of a cyclobutyl ring, which contributes to its cyclic nature and potential steric effects. The trimethylsilyl group attached to the ethynyl moiety enhances the compound's stability and solubility in organic solvents, making it useful in various chemical applications. The presence of the tert-butyl group (1,1-dimethylethyl) provides steric hindrance, which can influence the reactivity and interaction of the molecule with other substances. This compound may exhibit unique properties such as specific reactivity patterns, solubility characteristics, and potential applications in organic synthesis or as an intermediate in pharmaceutical development. As with many specialized chemical substances, handling and usage should adhere to safety protocols due to potential hazards associated with its chemical structure.

Formula: C₁₄H₂₅NO₂Si

InChI: InChI=1S/C14H25NO2Si/c1-13(2,3)17-12(16)15-14(8-7-9-14)10-11-18(4,5)6/h7-9H2,1-6H3,(H,15,16)

InChI key: InChIKey=NRDRDGQHYOUOAS-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1(C#C[Si](C)(C)C)CCC1

Synonyms:

• Carbamic acid, N-[1-[2-(trimethylsilyl)ethynyl]cyclobutyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[1-[2-(trimethylsilyl)ethynyl]cyclobutyl]carbamate