CAS 1268810-17-8

1-EthynylcyclopropanaMine hydrochloride

Description:

1-Ethynylcyclopropanamine hydrochloride is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and an ethynyl group. This compound is typically classified as an amine due to the presence of the amine functional group, which contributes to its basicity and potential reactivity. The hydrochloride salt form indicates that it is combined with hydrochloric acid, enhancing its solubility in water and making it more stable for various applications. The compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its molecular structure allows for potential interactions with biological targets, which could lead to various biological activities. However, specific details regarding its toxicity, safety profile, and detailed applications would require further investigation and research. As with any chemical substance, proper handling and safety precautions are essential when working with 1-Ethynylcyclopropanamine hydrochloride in laboratory or industrial settings.

Formula: C₅H₈ClN

InChI: InChI=1S/C5H7N.ClH/c1-2-5(6)3-4-5;/h1H,3-4,6H2;1H

InChI key: InChIKey=XBHDGYBZTODLSE-UHFFFAOYSA-N

SMILES: C(#C)C1(N)CC1.Cl

Synonyms:

• 1-Ethynylcyclopropan-1-amine hydrochloride
• 1-Ethynylcyclopropylamine hydrochloride
• Cyclopropanamine, 1-ethynyl-, hydrochloride (1:1)
• 1-Ethynylcyclopropanamine hydrochloride

Cyclopropanamine, 1-ethynyl-, hydrochloride (1:1)

CAS: 1268810-17-8

Formula: C₅H₈ClN

Purity: 95%

Color and Shape: Solid

Molecular weight: 117.5767

Ref: IN-DA000TFA

1-Ethynylcyclopropan-1-amine hydrochloride

CAS: 1268810-17-8

1-Ethynylcyclopropan-1-amine hydrochloride

Purity: 95%

Molecular weight: 117.58g/mol

Ref: 54-OR94968

1-ETHYNYLCYCLOPROPANAMINE HCL

CAS: 1268810-17-8

Formula: C₅H₈ClN

Purity: 95%

Color and Shape: Solid

Molecular weight: 117.58

Ref: 10-F468737