CAS 1268810-19-0

Cyclobutanamine, 1-ethynyl-, hydrochloride (1:1)

Description:

Cyclobutanamine, 1-ethynyl-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and an ethynyl group. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in water. This compound may exhibit properties typical of amines, such as basicity, and can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the ethynyl group suggests potential reactivity in alkyne chemistry, making it a candidate for further synthetic applications. Its molecular interactions may also be influenced by the cyclobutane ring's strain, which can affect its reactivity and stability. Cyclobutanamine derivatives are of interest in medicinal chemistry, potentially serving as precursors or intermediates in the synthesis of pharmaceuticals. However, specific biological activities and safety profiles would require further investigation through empirical studies. As with all chemical substances, proper handling and safety precautions should be observed when working with this compound.

Formula: C₆H₉N·ClH

InChI: InChI=1S/C6H9N.ClH/c1-2-6(7)4-3-5-6;/h1H,3-5,7H2;1H

InChI key: InChIKey=AXIXYIFPXKMVDC-UHFFFAOYSA-N

SMILES: C(#C)C1(N)CCC1.Cl

Synonyms:

• 1-Ethynylcyclobutan-1-amine hydrochloride
• Cyclobutanamine, 1-ethynyl-, hydrochloride (1:1)

1-Ethynylcyclobutan-1-amine hydrochloride

CAS: 1268810-19-0

Versatile small molecule scaffold

Formula: C₆H₁₀ClN

Purity: Min. 95%

Molecular weight: 131.6 g/mol

Ref: 3D-TAC81019