CAS 126882-55-1

Lanost-8-ene-2,3,12,24,25-pentol, 2-(hydrogen 3-hydroxy-3-methylpentanedioate), (2α,3β,12α,24R)-

Description:

Lanost-8-ene-2,3,12,24,25-pentol, 2-(hydrogen 3-hydroxy-3-methylpentanedioate), (2α,3β,12α,24R)- is a complex organic compound characterized by its lanostane skeleton, which is a tetracyclic triterpene structure. This substance features multiple hydroxyl groups, indicating its potential for forming hydrogen bonds, which can influence its solubility and reactivity. The presence of the 3-hydroxy-3-methylpentanedioate moiety suggests that it may participate in various biochemical pathways, possibly acting as a precursor or intermediate in metabolic processes. The stereochemistry denoted by the (2α,3β,12α,24R) configuration indicates specific spatial arrangements of its atoms, which can significantly affect its biological activity and interactions with other molecules. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and natural product research. Its CAS number, 126882-55-1, allows for precise identification and retrieval of information regarding its properties, synthesis, and applications in scientific literature.

Formula: C₃₆H₆₀O₉

InChI: InChI=1S/C36H60O9/c1-20(10-13-26(37)32(4,5)43)21-14-15-35(8)22-11-12-25-31(2,3)30(42)24(45-29(41)19-33(6,44)18-28(39)40)17-34(25,7)23(22)16-27(38)36(21,35)9/h20-21,24-27,30,37-38,42-44H,10-19H2,1-9H3,(H,39,40)

InChI key: InChIKey=SWRXIGFQDQTNKP-UHFFFAOYSA-N

SMILES: CC12C3=C(C4(C)C(CC3)C(C)(C)C(O)C(OC(CC(CC(O)=O)(C)O)=O)C4)CC(O)C1(C)C(C(CCC(C(C)(C)O)O)C)CC2

Synonyms:

• Lanost-8-ene-2,3,12,24,25-pentol, 2-(hydrogen 3-hydroxy-3-methylpentanedioate), (2α,3β,12α,24R)-
• Fasciculic acid B
• (+)-Fasciculic acid B

Fasciculic acid B

CAS: 126882-55-1

Fasciculic acid B: ester of fasciculol B, 3-hydroxy-methylglutaric acid; a calmodulin antagonist from Naematoloma fasciculare.

Formula: C₃₆H₆₀O₉

Purity: 98%

Color and Shape: Solid

Molecular weight: 636.86

Ref: TM-T25405