CAS 1268854-23-4

(αR)-α-(Methylamino)benzeneacetonitrile

Description:

(αR)-α-(Methylamino)benzeneacetonitrile, identified by its CAS number 1268854-23-4, is a chemical compound characterized by its structural features, which include a benzene ring, an acetonitrile group, and a methylamino substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and interactions. It is likely to be a solid at room temperature, with solubility in polar organic solvents due to the presence of the nitrile and amino functional groups. The methylamino group can participate in hydrogen bonding, influencing its physical properties and reactivity. Additionally, the stereochemistry indicated by the (αR) designation suggests specific spatial arrangements that may affect its biological activity and interactions with other molecules. Such compounds are often of interest in medicinal chemistry and drug development, where their unique characteristics can be leveraged for therapeutic applications. However, detailed safety and handling information should be consulted, as with any chemical substance.

Formula: C₉H₁₀N₂

InChI: InChI=1S/C9H10N2/c1-11-9(7-10)8-5-3-2-4-6-8/h2-6,9,11H,1H3/t9-/m0/s1

InChI key: InChIKey=DBCQXQGNNZDYMQ-VIFPVBQESA-N

SMILES: [C@@H](C#N)(NC)C1=CC=CC=C1

Synonyms:

• (2R)-2-(Methylamino)-2-phenylacetonitrile
• (αR)-α-(Methylamino)benzeneacetonitrile
• Benzeneacetonitrile, α-(methylamino)-, (αR)-