CymitQuimica logo

CAS 1268865-77-5

:

Ethyl 1,2,3,4-tetrahydro-2,3-dioxo-6-quinoxalinecarboxylate

Description:
Ethyl 1,2,3,4-tetrahydro-2,3-dioxo-6-quinoxalinecarboxylate is a chemical compound characterized by its unique structure, which includes a quinoxaline ring fused with a tetrahydro moiety and two carbonyl groups. This compound typically exhibits properties associated with both heterocyclic compounds and esters, including potential biological activity due to the presence of the quinoxaline framework, which is known for its pharmacological significance. The ethyl ester group contributes to its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. Additionally, the presence of dioxo groups suggests potential reactivity, particularly in nucleophilic addition reactions. Its molecular structure may also influence its interaction with biological targets, making it a candidate for further research in drug development. Overall, this compound represents a fascinating intersection of organic chemistry and pharmacology, warranting further investigation into its properties and potential applications.
Formula:C11H10N2O4
InChI:InChI=1S/C11H10N2O4/c1-2-17-11(16)6-3-4-7-8(5-6)13-10(15)9(14)12-7/h3-5H,2H2,1H3,(H,12,14)(H,13,15)
InChI key:InChIKey=ZYHOQGSGEKXSMW-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=C2C(=CC1)NC(=O)C(=O)N2
Synonyms:
  • 6-Quinoxalinecarboxylic acid, 1,2,3,4-tetrahydro-2,3-dioxo-, ethyl ester
  • Ethyl 1,2,3,4-tetrahydro-2,3-dioxo-6-quinoxalinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.