CAS 1269052-78-9

1H-Pyrazol-4-amine, 1,5-dimethyl-3-(1-pyrrolidinyl)-, hydrochloride (1:2)

Description:

1H-Pyrazol-4-amine, 1,5-dimethyl-3-(1-pyrrolidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of the 1,5-dimethyl substituents indicates that there are methyl groups attached to the first and fifth positions of the pyrazole ring, enhancing its lipophilicity and potentially influencing its biological activity. The 3-(1-pyrrolidinyl) group suggests that there is a pyrrolidine moiety attached at the third position, which may contribute to the compound's pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including pharmaceuticals. The compound's structure may suggest potential uses in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Its CAS number, 1269052-78-9, allows for precise identification and retrieval of information regarding its properties, synthesis, and safety data in chemical databases.

Formula: C₉H₁₆N₄·2ClH

InChI: InChI=1S/C9H16N4.2ClH/c1-7-8(10)9(11-12(7)2)13-5-3-4-6-13;;/h3-6,10H2,1-2H3;2*1H

InChI key: InChIKey=ORHBZXCLAFUDQC-UHFFFAOYSA-N

SMILES: NC=1C(=NN(C)C1C)N2CCCC2.Cl

Synonyms:

• 1H-Pyrazol-4-amine, 1,5-dimethyl-3-(1-pyrrolidinyl)-, hydrochloride (1:2)