CAS 1269052-82-5

1,4-Benzodioxin-2-methanamine, 2,3-dihydro-α-methyl-, ethanedioate (1:1)

Description:

1,4-Benzodioxin-2-methanamine, 2,3-dihydro-α-methyl-, ethanedioate (1:1), with the CAS number 1269052-82-5, is a chemical compound characterized by its unique structure that includes a benzodioxin moiety and an amine functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its reactivity and solubility. The presence of the ethanedioate (oxalate) component suggests potential for forming salts or complexes, which may enhance its stability or alter its solubility in various solvents. The α-methyl substitution indicates that it may exhibit stereochemical properties, potentially affecting its biological activity or interaction with other molecules. As with many compounds containing nitrogen, it may participate in hydrogen bonding, influencing its physical properties such as melting point and boiling point. Overall, the characteristics of this compound make it of interest in various fields, including medicinal chemistry and materials science, although specific applications would depend on further research into its biological and chemical behavior.

Formula: C₁₀H₁₃NO₂·C₂H₂O₄

InChI: InChI=1S/C10H13NO2.C2H2O4/c1-7(11)10-6-12-8-4-2-3-5-9(8)13-10;3-1(4)2(5)6/h2-5,7,10H,6,11H2,1H3;(H,3,4)(H,5,6)

InChI key: InChIKey=VMLWAAALRXTOLN-UHFFFAOYSA-N

SMILES: C(C)(N)C1OC=2C(OC1)=CC=CC2.C(C(O)=O)(O)=O

Synonyms:

• 1,4-Benzodioxin-2-methanamine, 2,3-dihydro-α-methyl-, ethanedioate (1:1)

[1-(2,3-dihydro-1,4-benzodioxin-2-yl)ethyl]amine oxalate

CAS: 1269052-82-5

Formula: C₁₂H₁₅NO₆

Purity: 95.0%

Molecular weight: 269.253

Ref: 10-F360939