CymitQuimica logo

CAS 1269052-83-6

:

5-Thiazolepropanamine, 4-methyl-, hydrochloride (1:1)

Description:
5-Thiazolepropanamine, 4-methyl-, hydrochloride (1:1) is a chemical compound characterized by its thiazole ring structure, which contributes to its biological activity and potential pharmacological properties. The presence of the amine group indicates that it can participate in hydrogen bonding, making it soluble in polar solvents, particularly water, due to the hydrochloride salt form. This compound may exhibit various biological activities, potentially including antimicrobial or anti-inflammatory effects, owing to the thiazole moiety's known reactivity and interaction with biological targets. Its molecular structure suggests that it could be involved in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. As with many organic compounds, safety and handling precautions are essential, as it may pose health risks if ingested or inhaled. Further research is necessary to fully elucidate its properties, mechanisms of action, and potential applications in medicinal chemistry or other fields.
Formula:C7H12N2S·ClH
InChI:InChI=1S/C7H12N2S.ClH/c1-6-7(3-2-4-8)10-5-9-6;/h5H,2-4,8H2,1H3;1H
InChI key:InChIKey=UTFUJSIVZUHCKW-UHFFFAOYSA-N
SMILES:C(CCN)C1=C(C)N=CS1.Cl
Synonyms:
  • 5-Thiazolepropanamine, 4-methyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.