CymitQuimica logo

CAS 1269054-83-2

:

1-Propanol, 3-[[(4-methylphenyl)methyl]amino]-, hydrochloride (1:1)

Description:
1-Propanol, 3-[[[4-methylphenyl)methyl]amino]-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a propanol backbone with a substituted amino group attached to a 4-methylphenyl moiety. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its stability and bioavailability. The presence of the 4-methylphenyl group suggests potential applications in pharmaceuticals, particularly in the development of drugs that may interact with biological targets. The hydrochloride form indicates that the compound can exist as a stable crystalline solid, making it easier to handle and store. Its properties, such as melting point, boiling point, and solubility, would be influenced by the presence of the hydrochloride group. Additionally, the compound may exhibit specific pharmacological activities, which would require further investigation through experimental studies to elucidate its potential therapeutic uses and mechanisms of action. Safety data and handling precautions should be considered due to the presence of the amine functional group.
Formula:C11H17NO·ClH
InChI:InChI=1S/C11H17NO.ClH/c1-10-3-5-11(6-4-10)9-12-7-2-8-13;/h3-6,12-13H,2,7-9H2,1H3;1H
InChI key:InChIKey=LRKPBEOIPVXIOR-UHFFFAOYSA-N
SMILES:C(NCCCO)C1=CC=C(C)C=C1.Cl
Synonyms:
  • 1-Propanol, 3-[[(4-methylphenyl)methyl]amino]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.