CAS 1269151-11-2

3H-1,2,4-Triazole-3-thione, 2,4-dihydro-4-(1-methylethyl)-5-(4-piperidinyl)-, hydrochloride (1:1)

Description:

3H-1,2,4-Triazole-3-thione, 2,4-dihydro-4-(1-methylethyl)-5-(4-piperidinyl)-, hydrochloride (1:1), with CAS number 1269151-11-2, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The compound also contains a piperidine moiety, a six-membered ring with a nitrogen atom, which is often associated with pharmacological properties. The hydrochloride salt form suggests enhanced solubility in water, making it suitable for various applications, particularly in medicinal chemistry. Its structural features may impart specific interactions with biological targets, potentially leading to therapeutic effects. As with many triazole derivatives, it may exhibit antifungal or antimicrobial properties, but detailed studies would be necessary to elucidate its specific biological activities and mechanisms of action.

Formula: C₁₀H₁₈N₄S·ClH

InChI: InChI=1S/C10H18N4S.ClH/c1-7(2)14-9(12-13-10(14)15)8-3-5-11-6-4-8;/h7-8,11H,3-6H2,1-2H3,(H,13,15);1H

InChI key: InChIKey=USWFDKJKXICOAZ-UHFFFAOYSA-N

SMILES: C(C)(C)N1C(=NNC1=S)C2CCNCC2.Cl

Synonyms:

• 3H-1,2,4-Triazole-3-thione, 2,4-dihydro-4-(1-methylethyl)-5-(4-piperidinyl)-, hydrochloride (1:1)

5-(Piperidin-4-yl)-4-(propan-2-yl)-4H-1,2,4-triazole-3-thiol hydrochloride

CAS: 1269151-11-2

Versatile small molecule scaffold

Formula: C₁₀H₁₉ClN₄S

Purity: Min. 95%

Molecular weight: 262.8 g/mol

Ref: 3D-UAC15111