CAS 1269151-73-6

Piperazine, 1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-, hydrochloride (1:2)

Description:

Piperazine, 1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. The presence of a 5-ethyl-1,2,4-oxadiazol-3-yl group indicates that it has a unique structure that may impart specific biological or pharmacological properties. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit properties such as antimicrobial, antifungal, or anti-inflammatory activities, although specific biological activities would depend on further empirical studies. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings.

Formula: C₉H₁₆N₄O·2ClH

InChI: InChI=1S/C9H16N4O.2ClH/c1-2-9-11-8(12-14-9)7-13-5-3-10-4-6-13;;/h10H,2-7H2,1H3;2*1H

InChI key: InChIKey=IYLFMTSCXOOKTF-UHFFFAOYSA-N

SMILES: C(C=1N=C(CC)ON1)N2CCNCC2.Cl

Synonyms:

• Piperazine, 1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-, hydrochloride (1:2)

1-[(5-Ethyl-1,2,4-oxadiazol-3-yl)methyl]piperazine dihydrochloride

CAS: 1269151-73-6

Versatile small molecule scaffold

Formula: C₉H₁₈Cl₂N₄O

Purity: Min. 95%

Molecular weight: 269.17 g/mol

Ref: 3D-UAC15173