CAS 1269152-00-2: 4-Oxazolecarboxylic acid, 5-(3-methyl-5-isoxazolyl)-, hydrochloride (1:1)

Description:4-Oxazolecarboxylic acid, 5-(3-methyl-5-isoxazolyl)-, hydrochloride (1:1) is a chemical compound characterized by its oxazole and isoxazole functional groups, which contribute to its heterocyclic structure. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group and the hydrochloride salt form. It is likely to be soluble in polar solvents, such as water and alcohols, owing to its ionic nature when in hydrochloride form. The presence of the isoxazole moiety may impart specific biological activities, making it of interest in pharmaceutical research. Additionally, the compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Its stability, reactivity, and interaction with biological systems would depend on various factors, including pH and temperature. As with many heterocyclic compounds, it may also exhibit unique spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization in laboratory settings.

Formula:C₈H₆N₂O₄.ClH

InChI:InChI=1S/C8H6N2O4.ClH/c1-4-2-5(14-10-4)7-6(8(11)12)9-3-13-7;/h2-3H,1H3,(H,11,12);1H

InChI key:InChIKey=UKFACOSFJLECPH-UHFFFAOYSA-N

SMILES:Cl.O=C(O)C=1N=COC1C=2ON=C(C2)C

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	5-(3-Methyl-1,2-oxazol-5-yl)-1,3-oxazole-4-carboxylic acid hydrochloride REF: 3D-UAC15200CAS: 1269152-00-2	Min. 95%	211.00 €~1,871.00 €	Fri 09 May 25
	5-(3-Methyl-1,2-oxazol-5-yl)-1,3-oxazole-4-carboxylic acid hydrochloride REF: 10-F671090CAS: 1269152-00-2	95%	- - -	Discontinued product