CAS 1269152-10-4: 1-Propanamine, 2-[(4-bromophenyl)thio]-, hydrochloride (1:1)

Description: 1-Propanamine, 2-[(4-bromophenyl)thio]-, hydrochloride (1:1) is an organic compound characterized by its amine functional group and a thioether linkage. The presence of the 4-bromophenyl group contributes to its aromatic properties and may influence its reactivity and solubility. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound's structure suggests potential biological activity, possibly as a precursor or intermediate in the synthesis of other chemical entities. Its molecular interactions may be influenced by the bromine substituent, which can affect electron density and steric hindrance. Additionally, the amine group may participate in hydrogen bonding, enhancing its solubility in polar solvents. Overall, this compound's unique characteristics make it of interest in medicinal chemistry and related fields, although specific applications would depend on further research into its biological properties and mechanisms of action.

Formula: C₉H₁₂BrNS·ClH

InChI: InChI=1S/C9H12BrNS.ClH/c1-7(6-11)12-9-4-2-8(10)3-5-9;/h2-5,7H,6,11H2,1H3;1H

InChI key: InChIKey=TUQFVBPMWWRKLM-UHFFFAOYSA-N

SMILES: Cl.BrC1=CC=C(SC(C)CN)C=C1

Synonyms:

• 1-Propanamine, 2-[(4-bromophenyl)thio]-, hydrochloride (1:1)

1-[(1-Aminopropan-2-yl)sulfanyl]-4-bromobenzene hydrochloride

CAS: 1269152-10-4

Versatile small molecule scaffold

• Formula: C₉H₁₃BrClNS
• Purity: Min. 95%
• Molecular weight: 282.63 g/mol

1-[(1-aminopropan-2-yl)sulfanyl]-4-bromobenzene hydrochloride

CAS: 1269152-10-4

• Purity: 95%
• Molecular weight: 282.6199951171875