CAS 1269152-17-1

1,1-Dimethylethyl N-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methoxy]phenyl]carbamate

Description:

1,1-Dimethylethyl N-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methoxy]phenyl]carbamate, identified by its CAS number 1269152-17-1, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a substituted phenyl ring. This compound features a dimethyl group that contributes to its steric hindrance, potentially influencing its reactivity and solubility. The presence of the 5-methyl-1,3,4-oxadiazole moiety suggests potential biological activity, as oxadiazoles are often associated with various pharmacological properties. The methoxy group enhances the compound's lipophilicity, which may affect its absorption and distribution in biological systems. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this substance may have applications in fields such as agrochemicals or pharmaceuticals, but specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₁₅H₁₉N₃O₄

InChI: InChI=1S/C15H19N3O4/c1-10-17-18-13(21-10)9-20-12-7-5-11(6-8-12)16-14(19)22-15(2,3)4/h5-8H,9H2,1-4H3,(H,16,19)

InChI key: InChIKey=JNDKMMBSTZFXLP-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1=CC=C(OCC2=NN=C(C)O2)C=C1

Synonyms:

• 1,1-Dimethylethyl N-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methoxy]phenyl]carbamate
• Carbamic acid, N-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methoxy]phenyl]-, 1,1-dimethylethyl ester

tert-Butyl N-{4-[(5-methyl-1,3,4-oxadiazol-2-yl)methoxy]phenyl}carbamate

CAS: 1269152-17-1

Versatile small molecule scaffold

Formula: C₁₅H₁₉N₃O₄

Purity: Min. 95%

Molecular weight: 305.33 g/mol

Ref: 3D-UAC15217