CymitQuimica logo

CAS 1269152-24-0

:

1,2,4-Oxadiazole-3-ethanamine, 5-(2-pyridinyl)-, hydrochloride (1:1)

Description:
1,2,4-Oxadiazole-3-ethanamine, 5-(2-pyridinyl)-, hydrochloride (1:1) is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features an ethanamine side chain, contributing to its amine functionality, and a pyridine moiety, which enhances its aromatic character and potential for biological activity. The hydrochloride form indicates that the compound is a salt, which typically improves its solubility in water and stability. The presence of the pyridine ring may suggest potential applications in medicinal chemistry, as pyridine derivatives are often associated with various pharmacological properties. The compound's structure may allow for interactions with biological targets, making it of interest in drug development. Additionally, the oxadiazole ring is known for its role in various chemical reactions and as a scaffold in the synthesis of bioactive molecules. Overall, this compound's unique structural features position it as a candidate for further research in both synthetic and medicinal chemistry.
Formula:C9H10N4O·ClH
InChI:InChI=1S/C9H10N4O.ClH/c10-5-4-8-12-9(14-13-8)7-3-1-2-6-11-7;/h1-3,6H,4-5,10H2;1H
InChI key:InChIKey=VXKLEHPACJGQTI-UHFFFAOYSA-N
SMILES:C(CN)C=1N=C(ON1)C2=CC=CC=N2.Cl
Synonyms:
  • 2-[5-(Pyridin-2-yl)-1,2,4-oxadiazol-3-yl]ethan-1-amine hydrochloride
  • 1,2,4-Oxadiazole-3-ethanamine, 5-(2-pyridinyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.