CAS 1269152-26-2

1H-Benzimidazole-2-ethanamine, 4-fluoro-1-methyl-, hydrochloride (1:2)

Description:

1H-Benzimidazole-2-ethanamine, 4-fluoro-1-methyl-, hydrochloride (1:2) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing a fused benzene and imidazole ring. The presence of a 4-fluoro substituent and a methyl group at the 1-position contributes to its unique chemical properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological effects, potentially acting as a ligand for specific receptors or enzymes due to its structural features. Its molecular interactions can be influenced by the functional groups present, which may affect its binding affinity and selectivity. The compound's stability, reactivity, and solubility are important characteristics that determine its behavior in biological systems and its suitability for drug formulation. As with many benzimidazole derivatives, it may also have implications in medicinal chemistry, particularly in the development of therapeutics targeting various diseases.

Formula: C₁₀H₁₂FN₃·2ClH

InChI: InChI=1S/C10H12FN3.2ClH/c1-14-8-4-2-3-7(11)10(8)13-9(14)5-6-12;;/h2-4H,5-6,12H2,1H3;2*1H

InChI key: InChIKey=IRLJVJWYHOTWNJ-UHFFFAOYSA-N

SMILES: FC1=C2C(N(C)C(CCN)=N2)=CC=C1.Cl

Synonyms:

• 1H-Benzimidazole-2-ethanamine, 4-fluoro-1-methyl-, hydrochloride (1:2)

2-(4-Fluoro-1-methyl-1H-1,3-benzodiazol-2-yl)ethan-1-amine dihydrochloride

Controlled Product

CAS: 1269152-26-2

Versatile small molecule scaffold

Formula: C₁₀H₁₄Cl₂FN₃

Purity: Min. 95%

Molecular weight: 266.14 g/mol

Ref: 3D-UAC15226