CAS 1269152-38-6

Benzoic acid, 2-amino-5-methyl-, methyl ester, hydrochloride (1:1)

Description:

Benzoic acid, 2-amino-5-methyl-, methyl ester, hydrochloride (1:1), commonly referred to as a methyl ester derivative of an amino-substituted benzoic acid, is a chemical compound characterized by its aromatic structure, which includes a benzoic acid moiety with an amino group and a methyl ester functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The amino group contributes to its basicity, while the carboxylic acid and ester functionalities can participate in various chemical reactions, including esterification and amidation. Its hydrochloride form enhances its stability and solubility in aqueous environments, making it useful in pharmaceutical applications. The compound may exhibit biological activity, potentially serving as an intermediate in the synthesis of pharmaceuticals or agrochemicals. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards.

Formula: C₉H₁₁NO₂·ClH

InChI: InChI=1S/C9H11NO2.ClH/c1-6-3-4-8(10)7(5-6)9(11)12-2;/h3-5H,10H2,1-2H3;1H

InChI key: InChIKey=TXUYYELZMUFQBD-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(N)C=CC(C)=C1.Cl

Synonyms:

• Benzoic acid, 2-amino-5-methyl-, methyl ester, hydrochloride (1:1)
• methyl 2-amino-5-methylbenzoate hydrochloride