CAS 1269152-39-7

N-(2-Chloro-6-nitrobenzoyl)glycine

Description:

N-(2-Chloro-6-nitrobenzoyl)glycine is an organic compound characterized by its structure, which includes a glycine moiety linked to a 2-chloro-6-nitrobenzoyl group. This compound features a benzene ring substituted with both a chlorine atom and a nitro group, contributing to its chemical reactivity and potential biological activity. The presence of the nitro group typically enhances the compound's electrophilicity, making it a candidate for various chemical reactions. Additionally, the amino acid glycine provides a site for potential interactions in biological systems, suggesting that this compound may have applications in pharmaceuticals or biochemistry. Its molecular properties, such as solubility and stability, can be influenced by the substituents on the benzene ring. As with many nitro-substituted compounds, it may exhibit specific toxicological profiles, necessitating careful handling and assessment in laboratory settings. Overall, N-(2-Chloro-6-nitrobenzoyl)glycine represents a unique chemical entity with potential utility in research and development.

Formula: C₉H₇ClN₂O₅

InChI: InChI=1S/C9H7ClN2O5/c10-5-2-1-3-6(12(16)17)8(5)9(15)11-4-7(13)14/h1-3H,4H2,(H,11,15)(H,13,14)

InChI key: InChIKey=DDSUIEKXBYCNFR-UHFFFAOYSA-N

SMILES: C(NCC(O)=O)(=O)C1=C(N(=O)=O)C=CC=C1Cl

Synonyms:

• N-(2-Chloro-6-nitrobenzoyl)glycine
• Glycine, N-(2-chloro-6-nitrobenzoyl)-

2-[(2-Chloro-6-nitrophenyl)formamido]acetic acid

CAS: 1269152-39-7

Versatile small molecule scaffold

Formula: C₉H₇ClN₂O₅

Purity: Min. 95%

Molecular weight: 258.61 g/mol

Ref: 3D-UAC15239