CAS 1269152-40-0

Benzamide, 4-methoxy-N-[2-(1-piperazinyl)ethyl]-, hydrochloride (1:2)

Description:

Benzamide, 4-methoxy-N-[2-(1-piperazinyl)ethyl]-, hydrochloride (1:2) is a chemical compound characterized by its benzamide structure, which includes a methoxy group at the para position and a piperazine moiety linked through a two-carbon ethyl chain. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous solutions, which is beneficial for pharmaceutical applications. The presence of the piperazine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of psychoactive or therapeutic agents. The compound's molecular structure contributes to its pharmacological properties, including its ability to cross biological membranes and interact with neurotransmitter systems. Additionally, the hydrochloride form often indicates a stable, crystalline solid that can be easily handled and formulated. As with many benzamide derivatives, it may exhibit a range of biological activities, including antipsychotic or anxiolytic effects, depending on its specific interactions within biological systems.

Formula: C₁₄H₂₁N₃O₂·2ClH

InChI: InChI=1S/C14H21N3O2.2ClH/c1-19-13-4-2-12(3-5-13)14(18)16-8-11-17-9-6-15-7-10-17;;/h2-5,15H,6-11H2,1H3,(H,16,18);2*1H

InChI key: InChIKey=CBXCCBGXXAPDSX-UHFFFAOYSA-N

SMILES: C(NCCN1CCNCC1)(=O)C2=CC=C(OC)C=C2.Cl

Synonyms:

• Benzamide, 4-methoxy-N-[2-(1-piperazinyl)ethyl]-, hydrochloride (1:2)

4-Methoxy-N-[2-(piperazin-1-yl)ethyl]benzamide dihydrochloride

CAS: 1269152-40-0

Versatile small molecule scaffold

Formula: C₁₄H₂₃Cl₂N₃O₂

Purity: Min. 95%

Molecular weight: 336.3 g/mol

Ref: 3D-UAC15240