CAS 1269152-41-1

3-[(Methylsulfonyl)methyl]-5-(trichloromethyl)-1,2,4-oxadiazole

Description:

3-[(Methylsulfonyl)methyl]-5-(trichloromethyl)-1,2,4-oxadiazole is a chemical compound characterized by its unique oxadiazole ring structure, which incorporates both a methylsulfonyl group and a trichloromethyl substituent. The presence of the methylsulfonyl group contributes to its potential as a polar and possibly water-soluble compound, while the trichloromethyl group may impart significant reactivity and influence its biological activity. This compound is likely to exhibit properties typical of oxadiazoles, such as potential antimicrobial or antifungal activity, making it of interest in pharmaceutical and agricultural applications. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions or electrophilic additions, due to the electron-withdrawing nature of the trichloromethyl group. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or environmental impact.

Formula: C₅H₅Cl₃N₂O₃S

InChI: InChI=1S/C5H5Cl3N2O3S/c1-14(11,12)2-3-9-4(13-10-3)5(6,7)8/h2H2,1H3

InChI key: InChIKey=OTAHAWXEQYYGEO-UHFFFAOYSA-N

SMILES: C(S(C)(=O)=O)C=1N=C(C(Cl)(Cl)Cl)ON1

Synonyms:

• 3-[(Methylsulfonyl)methyl]-5-(trichloromethyl)-1,2,4-oxadiazole
• 1,2,4-Oxadiazole, 3-[(methylsulfonyl)methyl]-5-(trichloromethyl)-

3-(Methanesulfonylmethyl)-5-(trichloromethyl)-1,2,4-oxadiazole

CAS: 1269152-41-1

Versatile small molecule scaffold

Formula: C₅H₅Cl₃N₂O₃S

Purity: Min. 95%

Molecular weight: 279.5 g/mol

Ref: 3D-UAC15241