CAS 1269152-56-8

Cyclobutanamine, 3-[4-(trifluoromethoxy)phenyl]-, hydrochloride (1:1)

Description:

Cyclobutanamine, 3-[4-(trifluoromethoxy)phenyl]-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and a phenyl group substituted with a trifluoromethoxy group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications, particularly in pharmaceutical research. The trifluoromethoxy group contributes to the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The presence of the hydrochloride form indicates that it can exist as a stable crystalline solid, which is advantageous for storage and handling. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. As with many chemical substances, safety data and handling precautions should be considered, especially due to the presence of fluorinated groups, which can exhibit unique reactivity and toxicity profiles.

Formula: C₁₁H₁₂F₃NO·ClH

InChI: InChI=1S/C11H12F3NO.ClH/c12-11(13,14)16-10-3-1-7(2-4-10)8-5-9(15)6-8;/h1-4,8-9H,5-6,15H2;1H

InChI key: InChIKey=LRXIAOHGKKDSKK-UHFFFAOYSA-N

SMILES: NC1CC(C2=CC=C(OC(F)(F)F)C=C2)C1.Cl

Synonyms:

• Cyclobutanamine, 3-[4-(trifluoromethoxy)phenyl]-, hydrochloride (1:1)

3-[4-(Trifluoromethoxy)phenyl]cyclobutan-1-amine hydrochloride

CAS: 1269152-56-8

Versatile small molecule scaffold

Formula: C₁₁H₁₃ClF₃NO

Purity: Min. 95%

Molecular weight: 267.67 g/mol

Ref: 3D-UAC15256