CAS 1269152-67-1

Benzenemethanamine, 2-(2-propyn-1-yloxy)-, hydrochloride (1:1)

Description:

Benzenemethanamine, 2-(2-propyn-1-yloxy)-, hydrochloride (1:1), with the CAS number 1269152-67-1, is a chemical compound characterized by its amine functional group and a propynyl ether moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The structure features a benzene ring, which contributes to its aromatic properties, and the propynyl group, which may impart unique reactivity and potential applications in organic synthesis or medicinal chemistry. As a hydrochloride salt, it is likely to exhibit basic properties, making it useful in various chemical reactions and formulations. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity. Overall, this compound may have applications in research and development, particularly in the fields of pharmaceuticals or agrochemicals.

Formula: C₁₀H₁₁NO·ClH

InChI: InChI=1S/C10H11NO.ClH/c1-2-7-12-10-6-4-3-5-9(10)8-11;/h1,3-6H,7-8,11H2;1H

InChI key: InChIKey=RIIILOUMTUZYJX-UHFFFAOYSA-N

SMILES: O(CC#C)C1=C(CN)C=CC=C1.Cl

Synonyms:

• Benzenemethanamine, 2-(2-propyn-1-yloxy)-, hydrochloride (1:1)

[2-(Prop-2-yn-1-yloxy)phenyl]methanamine hydrochloride

CAS: 1269152-67-1

Versatile small molecule scaffold

Formula: C₁₀H₁₂ClNO

Purity: Min. 95%

Molecular weight: 197.66 g/mol

Ref: 3D-UAC15267