CAS 1269152-72-8

Ethanamine, 2-[2-(1,1-dimethylethyl)phenoxy]-, hydrochloride (1:1)

Description:

Ethanamine, 2-[2-(1,1-dimethylethyl)phenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and a phenoxy moiety, which contributes to its potential biological activity. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its hydrophobic characteristics, influencing its solubility and interaction with biological membranes. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit properties such as being a potential ligand for receptors or enzymes, and its structure suggests it could have implications in medicinal chemistry. Its specific interactions and effects would depend on the context of its use, including concentration and the biological system involved. Safety data and handling precautions should be considered, as with any chemical substance, particularly those with amine functionalities, which can be reactive and may pose health risks if not managed properly.

Formula: C₁₂H₁₉NO·ClH

InChI: InChI=1S/C12H19NO.ClH/c1-12(2,3)10-6-4-5-7-11(10)14-9-8-13;/h4-7H,8-9,13H2,1-3H3;1H

InChI key: InChIKey=NBWVWZJUUYORRA-UHFFFAOYSA-N

SMILES: C(C)(C)(C)C1=C(OCCN)C=CC=C1.Cl

Synonyms:

• Ethanamine, 2-[2-(1,1-dimethylethyl)phenoxy]-, hydrochloride (1:1)

1-(2-Aminoethoxy)-2-tert-butylbenzene hydrochloride

CAS: 1269152-72-8

Versatile small molecule scaffold

Formula: C₁₂H₂₀ClNO

Purity: Min. 95%

Molecular weight: 229.74 g/mol

Ref: 3D-UAC15272