CAS 1269152-75-1

Quinoline, 8-fluoro-1,2,3,4-tetrahydro-5-methyl-, hydrochloride (1:1)

Description:

Quinoline, 8-fluoro-1,2,3,4-tetrahydro-5-methyl-, hydrochloride (1:1) is a chemical compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of a fluorine atom at the 8-position and a methyl group at the 5-position contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Additionally, the tetrahydro configuration indicates that it is a saturated derivative, which may influence its reactivity and stability. Overall, this compound represents a specific class of heterocyclic compounds with potential applications in drug development and research.

Formula: C₁₀H₁₂FN·ClH

InChI: InChI=1S/C10H12FN.ClH/c1-7-4-5-9(11)10-8(7)3-2-6-12-10;/h4-5,12H,2-3,6H2,1H3;1H

InChI key: InChIKey=QJPDFYQLQINQDB-UHFFFAOYSA-N

SMILES: CC1=C2C(=C(F)C=C1)NCCC2.Cl

Synonyms:

• Quinoline, 8-fluoro-1,2,3,4-tetrahydro-5-methyl-, hydrochloride (1:1)

8-Fluoro-5-methyl-1,2,3,4-tetrahydroquinoline hydrochloride

CAS: 1269152-75-1

Versatile small molecule scaffold

Formula: C₁₀H₁₃ClFN

Purity: Min. 95%

Molecular weight: 201.67 g/mol

Ref: 3D-UAC15275