CymitQuimica logo

CAS 126917-44-0

:

Benzene, 1-(2-chloro-1-methylenepropyl)-2,4-difluoro-, (R)-

Description:
Benzene, 1-(2-chloro-1-methylenepropyl)-2,4-difluoro-, (R)-, is a chemical compound characterized by its aromatic benzene ring substituted with a chloroalkyl group and two fluorine atoms at specific positions. The presence of the chloro group introduces a polar functional group, which can influence the compound's reactivity and solubility in various solvents. The difluoro substitutions enhance the compound's lipophilicity and may affect its biological activity, making it of interest in pharmaceutical applications. The (R)- designation indicates that the compound has a specific stereochemistry, which can be crucial for its interaction with biological systems. This compound is likely to exhibit typical properties of halogenated aromatic compounds, such as increased stability and potential for electrophilic substitution reactions. Additionally, its unique structure may impart specific physical properties, such as boiling and melting points, which are influenced by the presence of the halogen atoms and the overall molecular geometry. Safety and handling considerations are essential due to the presence of chlorine and fluorine, which can pose health and environmental risks.
Formula:C10H9ClF2
InChI:InChI=1S/C10H9ClF2/c1-6(7(2)11)9-4-3-8(12)5-10(9)13/h3-5,7H,1H2,2H3/t7-/m1/s1
InChI key:InChIKey=HUBSGDKELUJNGA-SSDOTTSWSA-N
SMILES:C([C@@H](C)Cl)(=C)C1=C(F)C=C(F)C=C1
Synonyms:
  • 1-[(3R)-3-Chlorobut-1-en-2-yl]-2,4-difluorobenzene
  • Benzene, 1-(2-chloro-1-methylenepropyl)-2,4-difluoro-, (R)-
  • 1-((r)-2-Chloro-1-methylene-propyl)-2,4-difluoro-benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.