CymitQuimica logo

CAS 126926-40-7

:

methyl 3-(ethylcarbamoyl)benzoate

Description:
Methyl 3-(ethylcarbamoyl)benzoate, with the CAS number 126926-40-7, is an organic compound characterized by its ester functional group and the presence of a carbamoyl substituent. It features a benzoate structure, where a methyl ester group is attached to a benzene ring that also bears an ethylcarbamoyl group at the meta position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which is common for esters, but may have limited solubility in water due to its hydrophobic aromatic ring. Methyl 3-(ethylcarbamoyl)benzoate may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its synthesis often involves the reaction of benzoic acid derivatives with ethyl carbamate and methanol, highlighting its potential utility in organic synthesis. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C11H13NO3
InChI:InChI=1/C11H13NO3/c1-3-12-10(13)8-5-4-6-9(7-8)11(14)15-2/h4-7H,3H2,1-2H3,(H,12,13)
SMILES:CCN=C(c1cccc(c1)C(=O)OC)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.