CAS 1269260-01-6

Methyl (3S,4R)-4-(4-methoxyphenyl)-3-pyrrolidinecarboxylate

Description:

Methyl (3S,4R)-4-(4-methoxyphenyl)-3-pyrrolidinecarboxylate is a chemical compound characterized by its specific stereochemistry and functional groups. It features a pyrrolidine ring, which is a five-membered cyclic amine, and a carboxylate ester functional group, indicating it can participate in various chemical reactions typical of esters. The presence of a methoxyphenyl group suggests that it has aromatic characteristics, which can influence its reactivity and solubility. The stereochemical descriptors (3S,4R) indicate the specific three-dimensional arrangement of atoms around the chiral centers, which can significantly affect the compound's biological activity and interactions. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, as compounds with similar structures are often explored for their effects on biological systems. Additionally, its molecular structure suggests it may exhibit lipophilic characteristics, which could influence its absorption and distribution in biological contexts. Overall, this compound represents a unique combination of features that may be valuable in various chemical and pharmaceutical applications.

Formula: C₁₃H₁₇NO₃

InChI: InChI=1S/C13H17NO3/c1-16-10-5-3-9(4-6-10)11-7-14-8-12(11)13(15)17-2/h3-6,11-12,14H,7-8H2,1-2H3/t11-,12+/m0/s1

InChI key: InChIKey=YZBHPTZUARKXKZ-NWDGAFQWSA-N

SMILES: C(OC)(=O)[C@H]1[C@@H](CNC1)C2=CC=C(OC)C=C2

Synonyms:

• 3-Pyrrolidinecarboxylic acid, 4-(4-methoxyphenyl)-, methyl ester, (3S,4R)-
• Methyl (3S,4R)-4-(4-methoxyphenyl)-3-pyrrolidinecarboxylate