CAS 1269291-02-2
:5-Bromo-1-(4-pyridinyl)-1H-pyrazole-4-carbonitrile
Description:
5-Bromo-1-(4-pyridinyl)-1H-pyrazole-4-carbonitrile is a heterocyclic organic compound characterized by its pyrazole and pyridine moieties. The presence of a bromine atom at the 5-position of the pyrazole ring contributes to its reactivity and potential applications in medicinal chemistry. The carbonitrile functional group at the 4-position enhances its polarity and can participate in various chemical reactions, making it a versatile building block in organic synthesis. This compound is typically solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure suggests potential biological activity, which has led to interest in its use as a pharmaceutical intermediate or in agrochemical applications. The compound's unique combination of functional groups may also allow for interactions with biological targets, making it a candidate for further research in drug development. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health risks.
Formula:C9H5BrN4
InChI:InChI=1S/C9H5BrN4/c10-9-7(5-11)6-13-14(9)8-1-3-12-4-2-8/h1-4,6H
InChI key:InChIKey=CYAZZVOFYCVGSS-UHFFFAOYSA-N
SMILES:BrC=1N(N=CC1C#N)C=2C=CN=CC2
Synonyms:- 5-Bromo-1-(4-pyridinyl)-1H-pyrazole-4-carbonitrile
- 1H-Pyrazole-4-carbonitrile, 5-bromo-1-(4-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
